CAS 898774-54-4

ethyl 2-[3-(3-methoxyphenyl)propanoyl]benzoate

Description:

Ethyl 2-[3-(3-methoxyphenyl)propanoyl]benzoate, identified by its CAS number 898774-54-4, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a complex structure that includes a benzoate moiety and a propanoyl group substituted with a methoxyphenyl group, contributing to its potential biological activity. Ethyl esters like this one are often used in organic synthesis and may exhibit various properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of the methoxy group can influence the compound's polarity and reactivity, potentially affecting its interactions in biological systems. Additionally, compounds of this nature may be investigated for their pharmacological properties, including anti-inflammatory or analgesic effects, making them of interest in medicinal chemistry. Overall, ethyl 2-[3-(3-methoxyphenyl)propanoyl]benzoate represents a versatile structure with potential applications in both research and industry.

Formula: C₁₉H₂₀O₄

InChI: InChI=1/C19H20O4/c1-3-23-19(21)17-10-5-4-9-16(17)18(20)12-11-14-7-6-8-15(13-14)22-2/h4-10,13H,3,11-12H2,1-2H3

SMILES: CCOC(=O)c1ccccc1C(=O)CCc1cccc(c1)OC

2′-carboethoxy-3-(3-methoxyphenyl)propiophenone

CAS: 898774-54-4

Formula: C₁₉H₂₀O₄

Purity: 97.0%

Molecular weight: 312.365

Ref: 10-F205839