CAS 898774-57-7
:Methanone, (2,3-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
Description:
Methanone, (2,3-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,3-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its physical and chemical properties, such as solubility and reactivity. The pyrrolidinylmethyl substituent suggests that the compound may exhibit biological activity, potentially interacting with various biological targets due to the presence of the nitrogen-containing pyrrolidine ring. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific pharmacological effects. Its molecular structure implies potential for various interactions, making it a candidate for further research in fields such as organic synthesis and pharmacology. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and biological activity.
Formula:C20H23NO
InChI:InChI=1S/C20H23NO/c1-15-8-7-11-18(16(15)2)20(22)19-10-4-3-9-17(19)14-21-12-5-6-13-21/h3-4,7-11H,5-6,12-14H2,1-2H3
InChI key:InChIKey=OPWSGUYZWCYVBC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=C(C)C(C)=CC=C3
Synonyms:- (2,3-Dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
- Methanone, (2,3-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
- 2,3-Dimethyl-2′-pyrrolidinomethyl benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.