CAS 898774-59-9

Methanone, (2,4-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,4-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,4-dimethylphenyl group indicates that the compound has two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and interaction with biological systems. The second aromatic component features a pyrrolidinylmethyl substituent, which introduces a nitrogen-containing heterocycle, enhancing the compound's potential for biological activity. This nitrogen atom can participate in hydrogen bonding and may influence the compound's solubility and pharmacokinetic properties. Overall, the compound's structure suggests it may exhibit interesting chemical behavior and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties, including stability, reactivity, and biological effects.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-15-9-10-18(16(2)13-15)20(22)19-8-4-3-7-17(19)14-21-11-5-6-12-21/h3-4,7-10,13H,5-6,11-12,14H2,1-2H3

InChI key: InChIKey=XIGFPSWESPRWPJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=C(C)C=C(C)C=C3

Synonyms:

• 2,4-Dimethyl-2′-pyrrolidinomethyl benzophenone
• Methanone, (2,4-dimethylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

2,4-dimethyl-2′-pyrrolidinomethyl benzophenone

CAS: 898774-59-9

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F205245