CAS 898774-60-2
:3-(3-methoxyphenyl)-1-(2-methylsulfanylphenyl)propan-1-one
Description:
3-(3-Methoxyphenyl)-1-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898774-60-2, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with two distinct aromatic groups. The presence of a methoxy group on one phenyl ring enhances its electron-donating properties, potentially influencing its reactivity and solubility. The second phenyl ring features a methylthio group, which can impart unique electronic and steric effects, affecting the compound's overall chemical behavior. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity. Further studies would be necessary to fully elucidate its characteristics and potential applications in various fields.
Formula:C17H18O2S
InChI:InChI=1/C17H18O2S/c1-19-14-7-5-6-13(12-14)10-11-16(18)15-8-3-4-9-17(15)20-2/h3-9,12H,10-11H2,1-2H3
SMILES:COc1cccc(CCC(=O)c2ccccc2SC)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.