CAS 898774-63-5
:(2,6-dimethylphenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (2,6-dimethylphenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898774-63-5, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a pyrrolidine moiety, indicating potential biological activity due to the presence of the nitrogen-containing heterocycle. The molecular structure suggests that it may exhibit lipophilic properties, allowing it to interact with various biological targets. Its potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of both aromatic and aliphatic components that can influence its reactivity and solubility. Additionally, the compound's unique arrangement of functional groups may contribute to its pharmacokinetic and pharmacodynamic profiles, making it a subject of interest in drug discovery and development. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C20H23NO
InChI:InChI=1/C20H23NO/c1-15-8-7-9-16(2)19(15)20(22)18-11-4-3-10-17(18)14-21-12-5-6-13-21/h3-4,7-11H,5-6,12-14H2,1-2H3
SMILES:Cc1cccc(C)c1C(=O)c1ccccc1CN1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.