CAS 898774-64-6

1-Propanone, 1-(3-bromophenyl)-3-(3-methoxyphenyl)-

Description:

1-Propanone, 1-(3-bromophenyl)-3-(3-methoxyphenyl)-, also known by its CAS number 898774-64-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a methoxyphenyl group. The presence of the bromine atom introduces notable electronegative characteristics, which can influence the compound's reactivity and polarity. The methoxy group, being an electron-donating substituent, can enhance the compound's solubility in organic solvents. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the specific functional groups present. It may participate in various chemical reactions typical of ketones, such as nucleophilic addition or oxidation. Additionally, due to its structural features, it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₆H₁₅BrO₂

InChI: InChI=1/C16H15BrO2/c1-19-15-7-2-4-12(10-15)8-9-16(18)13-5-3-6-14(17)11-13/h2-7,10-11H,8-9H2,1H3

InChI key: InChIKey=RNLDWFPGXRUKSI-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(Br)=CC=C1)C2=CC(OC)=CC=C2

Synonyms:

• 1-(3-Bromophenyl)-3-(3-methoxyphenyl)-1-propanone
• 3′-Bromo-3-(3-methoxyphenyl)propiophenone
• 1-Propanone, 1-(3-bromophenyl)-3-(3-methoxyphenyl)-