CymitQuimica logo

CAS 898774-66-8

:

1-(4-bromophenyl)-3-(3-methoxyphenyl)propan-1-one

Description:
1-(4-bromophenyl)-3-(3-methoxyphenyl)propan-1-one, with the CAS number 898774-66-8, is an organic compound characterized by its structure, which includes a propanone backbone substituted with a bromophenyl group and a methoxyphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic groups. The presence of the bromine atom introduces notable reactivity, potentially allowing for electrophilic substitution reactions. The methoxy group can influence the compound's electronic properties, enhancing its reactivity and solubility in organic media. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthetic applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H15BrO2
InChI:InChI=1/C16H15BrO2/c1-19-15-4-2-3-12(11-15)5-10-16(18)13-6-8-14(17)9-7-13/h2-4,6-9,11H,5,10H2,1H3
SMILES:COc1cccc(CCC(=O)c2ccc(cc2)Br)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.