CAS 898774-73-7

Methanone, (3-chloro-4-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The pyrrolidinylmethyl group indicates that the compound may exhibit properties relevant to medicinal chemistry, possibly influencing its interaction with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and biological effects.

Formula: C₁₈H₁₇ClFNO

InChI: InChI=1S/C18H17ClFNO/c19-16-11-13(7-8-17(16)20)18(22)15-6-2-1-5-14(15)12-21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2

InChI key: InChIKey=PIABEICXOSYLEE-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Cl)=C(F)C=C2)C=CC=C1)N3CCCC3

Synonyms:

• (3-Chloro-4-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• 3′-Chloro-4′-fluoro-2-pyrrolidinomethyl benzophenone

3′-chloro-4′-fluoro-2-pyrrolidinomethyl benzophenone

CAS: 898774-73-7

Formula: C₁₈H₁₇ClFNO

Purity: 97.0%

Molecular weight: 317.79

Ref: 10-F205252