CAS 898774-74-8

1-(4-Fluorophenyl)-3-(3-methoxyphenyl)-1-propanone

Description:

1-(4-Fluorophenyl)-3-(3-methoxyphenyl)-1-propanone, also known by its CAS number 898774-74-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone substituted with a 4-fluorophenyl group and a 3-methoxyphenyl group, which contribute to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect its electronic properties and reactivity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The molecular structure suggests that it may exhibit interesting interactions with biological targets due to the presence of aromatic rings, which can participate in π-π stacking and hydrophobic interactions. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₆H₁₅FO₂

InChI: InChI=1S/C16H15FO2/c1-19-15-4-2-3-12(11-15)5-10-16(18)13-6-8-14(17)9-7-13/h2-4,6-9,11H,5,10H2,1H3

InChI key: InChIKey=LPJOXPQQLGLIIH-UHFFFAOYSA-N

SMILES: C(CCC1=CC(OC)=CC=C1)(=O)C2=CC=C(F)C=C2

Synonyms:

• 1-Propanone, 1-(4-fluorophenyl)-3-(3-methoxyphenyl)-
• 1-(4-Fluorophenyl)-3-(3-methoxyphenyl)-1-propanone