CAS 898774-75-9

Methanone, (2-chlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a chlorophenyl group indicates that one of the phenyl rings is substituted with a chlorine atom, which can influence the compound's reactivity and physical properties. The pyrrolidinylmethyl substituent suggests that the compound may exhibit biological activity, potentially interacting with various biological targets due to the presence of the nitrogen-containing pyrrolidine ring. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting typical characteristics of similar aromatic compounds. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its behavior, including its stability, reactivity, and potential applications in various fields such as pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1S/C18H18ClNO/c19-17-10-4-3-9-16(17)18(21)15-8-2-1-7-14(15)13-20-11-5-6-12-20/h1-4,7-10H,5-6,11-13H2

InChI key: InChIKey=QRKDAYZDYXHLLF-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• Methanone, (2-chlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• (2-Chlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone

2-chloro-2′-pyrrolidinomethyl benzophenone

CAS: 898774-75-9

Formula: C₁₈H₁₈ClNO

Purity: 97.0%

Molecular weight: 299.8

Ref: 10-F205253