CAS 898774-81-7

Methanone, [2-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-

Description:

Methanone, [2-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of these rings is substituted with a pyrrolidinylmethyl group, while the other features a trifluoromethyl group, which significantly influences its chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. The pyrrolidine moiety may contribute to the compound's ability to interact with biological targets, potentially influencing its pharmacological profile. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the presence of functional groups and the overall electronic environment. As with many organic compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₉H₁₈F₃NO

InChI: InChI=1S/C19H18F3NO/c20-19(21,22)16-8-5-7-14(12-16)18(24)17-9-2-1-6-15(17)13-23-10-3-4-11-23/h1-2,5-9,12H,3-4,10-11,13H2

InChI key: InChIKey=NUIPAALBGFIBCP-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(C(F)(F)F)=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• [2-(1-Pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone
• Methanone, [2-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-
• 2-Pyrrolidinomethyl-3′-trifluoromethylbenzophenone

2-pyrrolidinomethyl-3′-trifluoromethylbenzophenone

CAS: 898774-81-7

Formula: C₁₉H₁₈F₃NO

Purity: 97.0%

Molecular weight: 333.354

Ref: 10-F205256