CAS 898774-83-9

Methanone, [2-(1-pyrrolidinylmethyl)phenyl][4-(trifluoromethyl)phenyl]-

Description:

Methanone, [2-(1-pyrrolidinylmethyl)phenyl][4-(trifluoromethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of the rings features a pyrrolidinylmethyl substituent, contributing to its potential biological activity, while the other ring is substituted with a trifluoromethyl group, which is known to enhance lipophilicity and metabolic stability. This compound is likely to exhibit interesting pharmacological properties due to the presence of the pyrrolidine moiety, which is often associated with various biological activities. The trifluoromethyl group can also influence the compound's reactivity and interaction with biological targets. As a synthetic organic compound, it may be utilized in medicinal chemistry research, particularly in the development of new therapeutic agents. Its specific applications and effects would depend on further studies, including its solubility, stability, and interaction with biological systems.

Formula: C₁₉H₁₈F₃NO

InChI: InChI=1S/C19H18F3NO/c20-19(21,22)16-9-7-14(8-10-16)18(24)17-6-2-1-5-15(17)13-23-11-3-4-12-23/h1-2,5-10H,3-4,11-13H2

InChI key: InChIKey=ANCOURQSNRSBFP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=CC=C(C(F)(F)F)C=C3

Synonyms:

• 2-Pyrrolidinomethyl-4′-trifluoromethylbenzophenone
• [2-(Pyrrolidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone
• Methanone, [2-(1-pyrrolidinylmethyl)phenyl][4-(trifluoromethyl)phenyl]-

2-pyrrolidinomethyl-4′-trifluoromethylbenzophenone

CAS: 898774-83-9

Formula: C₁₉H₁₈F₃NO

Purity: 97.0%

Molecular weight: 333.354

Ref: 10-F205257