CAS 898774-85-1
:(4-bromo-2-fluoro-phenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-bromo-2-fluoro-phenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898774-85-1, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a pyrrolidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of halogen substituents (bromo and fluoro) can influence its reactivity and lipophilicity, making it of interest in medicinal chemistry and drug design. Additionally, the pyrrolidine group may contribute to its pharmacological properties, potentially enhancing its ability to cross biological membranes. Overall, this compound's unique structural characteristics suggest it may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C18H17BrFNO
InChI:InChI=1/C18H17BrFNO/c19-14-7-8-16(17(20)11-14)18(22)15-6-2-1-5-13(15)12-21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2
SMILES:c1ccc(c(c1)CN1CCCC1)C(=O)c1ccc(cc1F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.