CAS 898774-86-2

1-(4-bromo-3-fluoro-phenyl)-3-(3-methoxyphenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(3-methoxyphenyl)propan-1-one, with the CAS number 898774-86-2, is an organic compound characterized by its complex structure featuring a propanone backbone. This substance contains a phenyl group substituted with a bromine and a fluorine atom, contributing to its unique reactivity and potential biological activity. The presence of a methoxy group on another phenyl ring enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be analyzed using techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its identity and purity. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity, particularly in the context of its potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₆H₁₄BrFO₂

InChI: InChI=1/C16H14BrFO2/c1-20-13-4-2-3-11(9-13)5-8-16(19)12-6-7-14(17)15(18)10-12/h2-4,6-7,9-10H,5,8H2,1H3

SMILES: COc1cccc(CCC(=O)c2ccc(c(c2)F)Br)c1

4′-bromo-3′-fluoro-3-(3-methoxyphenyl)propiophenone

CAS: 898774-86-2

Formula: C₁₆H₁₄BrFO₂

Purity: 97.0%

Molecular weight: 337.188

Ref: 10-F205856