CAS 898774-93-1

Methanone, (2,3-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and pyrrolidinylmethyl substituents indicates that it may exhibit significant biological activity, potentially interacting with various biological targets. The dichlorophenyl group contributes to the compound's lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the pyrrolidine moiety may enhance its pharmacological properties, possibly affecting its binding affinity to receptors or enzymes. This compound is likely to be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents. Its specific properties, such as melting point, boiling point, and reactivity, would require empirical investigation to fully understand its behavior in various chemical environments. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-16-9-5-8-15(17(16)20)18(22)14-7-2-1-6-13(14)12-21-10-3-4-11-21/h1-2,5-9H,3-4,10-12H2

InChI key: InChIKey=BNSRCDYGKFIWRV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• Methanone, (2,3-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• 2,3-Dichloro-2′-pyrrolidinomethyl benzophenone
• (2,3-Dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone