CymitQuimica logo

CAS 898774-95-3

:

Methanone, (2,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:
Methanone, (2,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that the compound has chlorine substituents at the 2 and 4 positions of the phenyl ring, which can influence its reactivity and biological activity. Additionally, the compound features a pyrrolidinylmethyl group, suggesting potential interactions with biological systems, particularly in pharmacology. This structure may confer specific properties such as lipophilicity, which can affect its solubility and permeability in biological membranes. The compound's molecular interactions and potential applications could be significant in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and potential therapeutic effects. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of halogenated groups.
Formula:C18H17Cl2NO
InChI:InChI=1S/C18H17Cl2NO/c19-14-7-8-16(17(20)11-14)18(22)15-6-2-1-5-13(15)12-21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2
InChI key:InChIKey=AVFDQAJRTXJNOJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=C(Cl)C=C(Cl)C=C3
Synonyms:
  • (2,4-Dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
  • Methanone, (2,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
  • 2,4-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
  • (2,4-Dichlorophenyl)(2-(pyrrolidin-1-ylmethyl)phenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.