CAS 898774-96-4

3-(3-methoxyphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(3-Methoxyphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898774-96-4, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a methoxyphenyl group and a trifluoromethylphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. The methoxy group can also affect the compound's electronic properties and solubility. As a result, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, which can be explored further through experimental studies and computational modeling.

Formula: C₁₇H₁₅F₃O₂

InChI: InChI=1/C17H15F3O2/c1-22-13-6-4-5-12(11-13)9-10-16(21)14-7-2-3-8-15(14)17(18,19)20/h2-8,11H,9-10H2,1H3

SMILES: COc1cccc(CCC(=O)c2ccccc2C(F)(F)F)c1