CAS 898774-98-6

1-Propanone, 3-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is indicative of its reactivity and properties. This substance features a propanone backbone with two distinct aromatic substituents: a methoxyphenyl group and a trifluoromethylphenyl group. The presence of the methoxy group enhances its electron-donating characteristics, while the trifluoromethyl group introduces significant electronegativity, influencing the compound's overall polarity and reactivity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature and functional groups. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, where the unique combination of substituents may impart specific biological activities or chemical reactivity. Additionally, the trifluoromethyl group can enhance lipophilicity, potentially affecting the compound's bioavailability and interaction with biological systems. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.

Formula: C₁₇H₁₅F₃O₂

InChI: InChI=1S/C17H15F3O2/c1-22-15-7-2-4-12(10-15)8-9-16(21)13-5-3-6-14(11-13)17(18,19)20/h2-7,10-11H,8-9H2,1H3

InChI key: InChIKey=YFXHXYWJVOSMDM-UHFFFAOYSA-N

SMILES: C(CCC1=CC(OC)=CC=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 3-(3-Methoxyphenyl)-3′-trifluoromethylpropiophenone
• 1-Propanone, 3-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-
• 3-(3-Methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone

3-(3-methoxyphenyl)-3′-trifluoromethylpropiophenone

CAS: 898774-98-6

Formula: C₁₇H₁₅F₃O₂

Purity: 97.0%

Molecular weight: 308.3

Ref: 10-F205862