CAS 898774-99-7

Methanone, (3,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that chlorine substituents are attached to the aromatic ring, which can influence the compound's reactivity and biological activity. The pyrrolidinylmethyl group suggests that the compound may exhibit properties related to psychoactive or pharmacological effects, as pyrrolidine derivatives are often associated with various biological activities. This compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry or as a research chemical. Its molecular interactions may be influenced by the electron-withdrawing nature of the chlorine atoms and the steric effects of the bulky aromatic groups. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-16-8-7-13(11-17(16)20)18(22)15-6-2-1-5-14(15)12-21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2

InChI key: InChIKey=NZLISMODMBDZBN-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Cl)=C(Cl)C=C2)C=CC=C1)N3CCCC3

Synonyms:

• (3,4-Dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-