CAS 898775-00-3

3-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(3-Methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898775-00-3, is an organic compound characterized by its complex structure featuring a propanone backbone. This substance includes a methoxy group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the methoxy group typically enhances the compound's solubility in organic solvents and may affect its electronic properties, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. The trifluoromethyl group is known for imparting unique characteristics, such as increased lipophilicity and metabolic stability, which can enhance the biological activity of the compound. Additionally, this compound may exhibit interesting photophysical properties, making it relevant in fields such as materials science and pharmaceuticals. Its specific interactions and reactivity would depend on the surrounding environment and the presence of other functional groups, making it a subject of interest for further research in chemical and biological applications.

Formula: C₁₇H₁₅F₃O₂

InChI: InChI=1/C17H15F3O2/c1-22-15-4-2-3-12(11-15)5-10-16(21)13-6-8-14(9-7-13)17(18,19)20/h2-4,6-9,11H,5,10H2,1H3

SMILES: COc1cccc(CCC(=O)c2ccc(cc2)C(F)(F)F)c1