CAS 898775-09-2

Methanone, (3,5-difluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its electronic properties and reactivity. The pyrrolidinylmethyl substituent suggests that the compound may exhibit certain biological activities, potentially interacting with various biological targets due to the presence of the pyrrolidine ring, which is known for its role in pharmacology. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could confer specific biological activities. Additionally, the presence of fluorine atoms often enhances the metabolic stability and lipophilicity of organic molecules, making them more suitable for drug development. Overall, this compound exemplifies the intricate relationship between molecular structure and potential biological function.

Formula: C₁₈H₁₇F₂NO

InChI: InChI=1S/C18H17F2NO/c19-15-9-14(10-16(20)11-15)18(22)17-6-2-1-5-13(17)12-21-7-3-4-8-21/h1-2,5-6,9-11H,3-4,7-8,12H2

InChI key: InChIKey=XUKVWLMOYONVKL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=CC(F)=CC(F)=C3

Synonyms:

• Methanone, (3,5-difluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• (3,5-Difluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone