CAS 898775-10-5

1-(4-chloro-2-fluoro-phenyl)-3-(3-methoxyphenyl)propan-1-one

Description:

1-(4-chloro-2-fluoro-phenyl)-3-(3-methoxyphenyl)propan-1-one, with the CAS number 898775-10-5, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl group substituted with both a chloro and a fluoro atom, contributing to its unique electronic properties and potential reactivity. The presence of a methoxy group on another phenyl ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The specific arrangement of substituents can affect the compound's solubility, stability, and interaction with biological targets. Additionally, the presence of halogens like chlorine and fluorine often imparts distinctive characteristics such as increased metabolic stability and altered pharmacokinetics. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1/C16H14ClFO2/c1-20-13-4-2-3-11(9-13)5-8-16(19)14-7-6-12(17)10-15(14)18/h2-4,6-7,9-10H,5,8H2,1H3

SMILES: COc1cccc(CCC(=O)c2ccc(cc2F)Cl)c1

4′-chloro-2′-fluoro-3-(3-methoxyphenyl)propiophenone

CAS: 898775-10-5

Formula: C₁₆H₁₄ClFO₂

Purity: 97.0%

Molecular weight: 292.73

Ref: 10-F205867