CAS 898775-11-6

Methanone, (3,4-dimethylphenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[4-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that the compound has two methyl substituents on the phenyl ring, which can influence its electronic properties and steric hindrance. Additionally, the 4-(1-piperidinylmethyl)phenyl moiety introduces a piperidine ring, a six-membered nitrogen-containing heterocycle, which can enhance the compound's biological activity and solubility. This compound may exhibit various chemical properties, such as potential reactivity due to the carbonyl group and the ability to participate in hydrogen bonding due to the nitrogen in the piperidine. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including solubility, stability, and biological activity.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-6-9-20(14-17(16)2)21(23)19-10-7-18(8-11-19)15-22-12-4-3-5-13-22/h6-11,14H,3-5,12-13,15H2,1-2H3

InChI key: InChIKey=JWMNVYGUOZMEOU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=C(C)C=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• Methanone, (3,4-dimethylphenyl)[4-(1-piperidinylmethyl)phenyl]-
• (3,4-Dimethylphenyl)[4-(1-piperidinylmethyl)phenyl]methanone

3,4-dimethyl-4′-piperidinomethyl benzophenone

CAS: 898775-11-6

Formula: C₂₁H₂₅NO

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F204281