CAS 898775-15-0
:cyclopropyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
Cyclopropyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, identified by its CAS number 898775-15-0, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, attached to a phenyl ring that is further substituted with a pyrrolidine moiety. The presence of the pyrrolidine ring, a five-membered nitrogen-containing heterocycle, contributes to the compound's potential biological activity and pharmacological properties. The methanone functional group indicates the presence of a carbonyl group (C=O) adjacent to the cyclopropyl and phenyl structures, which can influence the compound's reactivity and interactions with biological targets. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of new therapeutic agents, due to the combination of its cyclic structures and functional groups. However, specific data regarding its solubility, stability, and biological activity would require further investigation through experimental studies.
Formula:C15H19NO
InChI:InChI=1/C15H19NO/c17-15(12-7-8-12)14-6-2-1-5-13(14)11-16-9-3-4-10-16/h1-2,5-6,12H,3-4,7-11H2
SMILES:c1ccc(c(c1)CN1CCCC1)C(=O)C1CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.