CAS 898775-17-2

Methanone, (4-bromo-3-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-bromo-3-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The piperidinylmethyl group enhances its solubility and may influence its pharmacological properties. This compound is likely to exhibit significant lipophilicity due to its aromatic components, which can affect its interaction with biological membranes. Additionally, the presence of halogens can impact its electronic properties, making it a candidate for various applications in medicinal chemistry and drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent, temperature, and the presence of other reactive species. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₁₉H₁₉BrFNO

InChI: InChI=1S/C19H19BrFNO/c20-17-9-8-16(12-18(17)21)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2

InChI key: InChIKey=SFKNJLKYJCBQCP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(Br)C=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• Methanone, (4-bromo-3-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
• (4-Bromo-3-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone