CAS 898775-18-3

Cyclobutyl[2-(1-pyrrolidinylmethyl)phenyl]methanone

Description:

Cyclobutyl[2-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898775-18-3, is a synthetic organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a phenyl ring substituted with a pyrrolidinylmethyl group, contributing to its potential biological activity. The presence of the ketone functional group (methanone) indicates that it has a carbonyl moiety, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting pharmacological properties due to the combination of its cyclic and aromatic structures, which can influence its interaction with biological targets. Additionally, the pyrrolidine moiety is known for its role in enhancing solubility and bioavailability in drug design. As with many synthetic compounds, its stability, reactivity, and potential applications in medicinal chemistry would depend on the specific conditions under which it is studied. Further research would be necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₂₁NO

InChI: InChI=1S/C16H21NO/c18-16(13-7-5-8-13)15-9-2-1-6-14(15)12-17-10-3-4-11-17/h1-2,6,9,13H,3-5,7-8,10-12H2

InChI key: InChIKey=VOJYXYVOZKXUKP-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2CCC2)C=CC=C1)N3CCCC3

Synonyms:

• Methanone, cyclobutyl[2-(1-pyrrolidinylmethyl)phenyl]-
• Cyclobutyl[2-(1-pyrrolidinylmethyl)phenyl]methanone