CymitQuimica logo

CAS 898775-20-7

:

(4-chloro-3-fluoro-phenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:
The chemical substance known as (4-chloro-3-fluoro-phenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898775-20-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a piperidine moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the piperidine ring, which is often involved in interactions with biological targets. The chlorofluorophenyl group may contribute to its lipophilicity and influence its solubility in organic solvents. Additionally, the methanone functional group suggests potential reactivity in various chemical reactions, including nucleophilic attacks. The compound's unique structure may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values.
Formula:C19H19ClFNO
InChI:InChI=1/C19H19ClFNO/c20-17-9-8-16(12-18(17)21)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2
SMILES:C1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccc(c(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.