CAS 898775-24-1
:Cyclohexyl[2-(1-pyrrolidinylmethyl)phenyl]methanone
Description:
Cyclohexyl[2-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898775-24-1, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclohexyl group, a phenyl ring, and a pyrrolidine moiety. This compound typically exhibits properties associated with ketones, such as a relatively high boiling point and solubility in organic solvents. The presence of the pyrrolidine group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its structure may confer specific pharmacological properties, potentially influencing its activity as a ligand or in other chemical reactions. As with many organic compounds, its stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other functional groups. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields, including pharmaceuticals and materials science.
Formula:C18H25NO
InChI:InChI=1/C18H25NO/c20-18(15-8-2-1-3-9-15)17-11-5-4-10-16(17)14-19-12-6-7-13-19/h4-5,10-11,15H,1-3,6-9,12-14H2
InChI key:InChIKey=OOOGWHRYZIEDKE-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3CCCCC3
Synonyms:- Methanone, cyclohexyl[2-(1-pyrrolidinylmethyl)phenyl]-
- Cyclohexyl[2-(1-pyrrolidinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.