CAS 898775-26-3

(2-chlorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (2-chlorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898775-26-3, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It may possess moderate to high lipophilicity due to the presence of aromatic rings and a piperidine moiety, which can influence its solubility in organic solvents. The presence of the chlorine atom can also affect its reactivity and biological activity. Compounds of this nature are often studied for their potential pharmacological applications, particularly in medicinal chemistry, where they may exhibit activity against various biological targets. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1/C19H20ClNO/c20-18-7-3-2-6-17(18)19(22)16-10-8-15(9-11-16)14-21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-14H2

SMILES: C1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccccc1Cl