CAS 898775-27-4
:ethyl 4-oxo-4-[2-(pyrrolidin-1-ylmethyl)phenyl]butanoate
Description:
Ethyl 4-oxo-4-[2-(pyrrolidin-1-ylmethyl)phenyl]butanoate, identified by its CAS number 898775-27-4, is a synthetic organic compound characterized by its complex structure, which includes an ester functional group, a ketone, and a pyrrolidine moiety. This compound typically exhibits moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can influence its solubility in organic solvents. The pyrrolidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may participate in various chemical reactions, such as nucleophilic substitutions or reductions, due to the presence of reactive functional groups. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders, given the presence of the pyrrolidine moiety. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C17H23NO3
InChI:InChI=1/C17H23NO3/c1-2-21-17(20)10-9-16(19)15-8-4-3-7-14(15)13-18-11-5-6-12-18/h3-4,7-8H,2,5-6,9-13H2,1H3
SMILES:CCOC(=O)CCC(=O)c1ccccc1CN1CCCC1
Synonyms:- Benzenebutanoic acid, γ-oxo-2-(1-pyrrolidinylmethyl)-, ethyl ester
- ETHYL 4-OXO-4-[2-(PYRROLIDINOMETHYL)PHENYL]BUTYRATE
- ethyl 4-oxo-4-[2-(pyrrolidin-1-ylmethyl)phenyl]butanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.