CymitQuimica logo

CAS 898775-29-6

:

Methanone, (2-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:
Methanone, (2-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a fluorine atom on one of the phenyl rings contributes to its unique electronic properties, potentially influencing its reactivity and interactions with biological targets. The piperidinylmethyl group introduces a nitrogen-containing heterocycle, which can enhance solubility and may play a role in pharmacological activity. This compound is likely to exhibit properties typical of both ketones and aromatic compounds, such as stability under standard conditions and potential for hydrogen bonding due to the presence of the nitrogen atom. Its specific applications may vary, but compounds of this nature are often investigated in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, the precise characteristics, including solubility, melting point, and reactivity, would depend on the specific conditions and environment in which the compound is studied.
Formula:C19H20FNO
InChI:InChI=1/C19H20FNO/c20-18-7-3-2-6-17(18)19(22)16-10-8-15(9-11-16)14-21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-14H2
InChI key:InChIKey=KPSZNZQNDRJODV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3=C(F)C=CC=C3
Synonyms:
  • Methanone, (2-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
  • (2-fluorophenyl)-[4-(piperidin-1-ylmethyl)phenyl]methanone
  • 2-FLUORO-4'-PIPERIDINOMETHYL BENZOPHENONE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.