CAS 898775-30-9
:Ethyl δ-oxo-2-(1-pyrrolidinylmethyl)benzenepentanoate
Description:
Ethyl δ-oxo-2-(1-pyrrolidinylmethyl)benzenepentanoate, identified by its CAS number 898775-30-9, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a pyrrolidine moiety. This compound typically exhibits properties common to esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the pyrrolidine ring suggests potential biological activity, as pyrrolidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound may also display characteristics such as stability under standard conditions, but its reactivity can vary depending on the functional groups present. Additionally, it may participate in various chemical reactions, including esterification and nucleophilic substitutions, making it a versatile intermediate in organic synthesis. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C18H25NO3
InChI:InChI=1S/C18H25NO3/c1-2-22-18(21)11-7-10-17(20)16-9-4-3-8-15(16)14-19-12-5-6-13-19/h3-4,8-9H,2,5-7,10-14H2,1H3
InChI key:InChIKey=MRUNJKILMAUUTO-UHFFFAOYSA-N
SMILES:C(C1=C(C(CCCC(OCC)=O)=O)C=CC=C1)N2CCCC2
Synonyms:- Benzenepentanoic acid, δ-oxo-2-(1-pyrrolidinylmethyl)-, ethyl ester
- Ethyl δ-oxo-2-(1-pyrrolidinylmethyl)benzenepentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.