CAS 898775-31-0
:1-(3,4-difluorophenyl)-3-(3-methoxyphenyl)propan-1-one
Description:
1-(3,4-Difluorophenyl)-3-(3-methoxyphenyl)propan-1-one, identified by its CAS number 898775-31-0, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,4-difluorophenyl group and a 3-methoxyphenyl group. The presence of fluorine atoms in the aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. The methoxy group contributes to the compound's overall polarity and can affect its solubility in various solvents. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The structural complexity and the presence of multiple functional groups suggest that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C16H14F2O2
InChI:InChI=1/C16H14F2O2/c1-20-13-4-2-3-11(9-13)5-8-16(19)12-6-7-14(17)15(18)10-12/h2-4,6-7,9-10H,5,8H2,1H3
SMILES:COc1cccc(CCC(=O)c2ccc(c(c2)F)F)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.