CAS 898775-34-3

1-Propanone, 1-(3,5-difluorophenyl)-3-(3-methoxyphenyl)-

Description:

1-Propanone, 1-(3,5-difluorophenyl)-3-(3-methoxyphenyl)-, also known by its CAS number 898775-34-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,5-difluorophenyl group and a 3-methoxyphenyl group. The presence of fluorine atoms in the difluorophenyl group can influence the compound's electronic properties, potentially enhancing its reactivity and altering its physical characteristics, such as boiling and melting points. The methoxy group contributes to the compound's polarity and can affect solubility in various solvents. Generally, compounds of this nature may exhibit interesting biological activities, making them of interest in pharmaceutical research. Additionally, the presence of multiple functional groups can lead to diverse chemical reactivity, allowing for potential applications in organic synthesis and material science. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research.

Formula: C₁₆H₁₄F₂O₂

InChI: InChI=1S/C16H14F2O2/c1-20-15-4-2-3-11(7-15)5-6-16(19)12-8-13(17)10-14(18)9-12/h2-4,7-10H,5-6H2,1H3

InChI key: InChIKey=IDWLEZAPDJXOSB-UHFFFAOYSA-N

SMILES: C(CCC1=CC(OC)=CC=C1)(=O)C2=CC(F)=CC(F)=C2

Synonyms:

• 1-(3,5-Difluorophenyl)-3-(3-methoxyphenyl)-1-propanone
• 1-Propanone, 1-(3,5-difluorophenyl)-3-(3-methoxyphenyl)-
• 3′,5′-Difluoro-3-(3-methoxyphenyl)propiophenone