CAS 898775-43-4
:1-Cyclobutyl-3-(3-methoxyphenyl)-1-propanone
Description:
1-Cyclobutyl-3-(3-methoxyphenyl)-1-propanone, identified by its CAS number 898775-43-4, is an organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a propanone functional group, indicating the presence of a ketone. The compound also includes a 3-methoxyphenyl substituent, which introduces an aromatic ring with a methoxy group (-OCH3) at the para position. This combination of cyclic and aromatic structures contributes to its potential reactivity and physical properties. Typically, such compounds may exhibit moderate to high lipophilicity due to the presence of the aromatic ring, influencing their solubility in organic solvents. The presence of the ketone functional group suggests potential reactivity in nucleophilic addition reactions. Additionally, the compound may have applications in organic synthesis or medicinal chemistry, although specific biological activities would require further investigation. Overall, 1-Cyclobutyl-3-(3-methoxyphenyl)-1-propanone represents a complex organic molecule with diverse chemical characteristics.
Formula:C14H18O2
InChI:InChI=1S/C14H18O2/c1-16-13-7-2-4-11(10-13)8-9-14(15)12-5-3-6-12/h2,4,7,10,12H,3,5-6,8-9H2,1H3
InChI key:InChIKey=KXYHDASFFJMLHS-UHFFFAOYSA-N
SMILES:C(CCC1=CC(OC)=CC=C1)(=O)C2CCC2
Synonyms:- 1-Cyclobutyl-3-(3-methoxyphenyl)-1-propanone
- 1-Propanone, 1-cyclobutyl-3-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.