CAS 898775-44-5
:Methanone, (2-chloro-4-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
Description:
Methanone, (2-chloro-4-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit pharmacological properties, as piperidine derivatives are often found in various therapeutic agents. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, and may exhibit specific interactions with biological targets due to its structural features. Its molecular interactions could be of interest in medicinal chemistry, particularly in the development of new drugs. As with many synthetic compounds, safety and handling precautions should be observed, as the presence of halogens can affect toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C19H19ClFNO
InChI:InChI=1S/C19H19ClFNO/c20-18-12-16(21)8-9-17(18)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2
InChI key:InChIKey=RXSHLAAHJUFXTJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC=C(CN3CCCCC3)C=C2
Synonyms:- (2-Chloro-4-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone
- 2-Chloro-4-fluoro-4′-piperidinomethyl benzophenone
- Methanone, (2-chloro-4-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.