CAS 898775-46-7
:3-(4-methoxyphenyl)-1-(o-tolyl)propan-1-one
Description:
3-(4-Methoxyphenyl)-1-(o-tolyl)propan-1-one, also known by its CAS number 898775-46-7, is an organic compound characterized by its ketone functional group and aromatic substituents. This compound features a propanone backbone with a methoxyphenyl group and an ortho-tolyl group attached, contributing to its unique structural and chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of the methoxy group can influence its reactivity and polarity, potentially affecting its interactions in chemical reactions. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-13-5-3-4-6-16(13)17(18)12-9-14-7-10-15(19-2)11-8-14/h3-8,10-11H,9,12H2,1-2H3
SMILES:Cc1ccccc1C(=O)CCc1ccc(cc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.