CymitQuimica logo

CAS 898775-47-8

:

(3-Chloro-5-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone

Description:
(3-Chloro-5-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone, with the CAS number 898775-47-8, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a piperidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the piperidine group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the halogen substituents (chlorine and fluorine) can enhance lipophilicity and metabolic stability, which are important factors in drug design. The compound's molecular structure may also confer specific reactivity patterns, making it suitable for various chemical reactions. Overall, (3-Chloro-5-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of medicinal chemistry and drug development.
Formula:C19H19ClFNO
InChI:InChI=1S/C19H19ClFNO/c20-17-10-16(11-18(21)12-17)19(23)15-6-4-14(5-7-15)13-22-8-2-1-3-9-22/h4-7,10-12H,1-3,8-9,13H2
InChI key:InChIKey=LSZCQGVMRPYPKP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC=C(CN3CCCCC3)C=C2
Synonyms:
  • Methanone, (3-chloro-5-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
  • 3-Chloro-5-fluoro-4′-piperidinomethyl benzophenone
  • (3-Chloro-5-fluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.