CAS 898775-55-8

Methanone, (2,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties relevant to pharmacology, potentially interacting with biological targets due to the piperidine moiety's ability to form hydrogen bonds and engage in various molecular interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it combines features that could enhance its efficacy and selectivity. Additionally, the presence of halogen atoms like chlorine can affect the compound's lipophilicity and metabolic stability. Overall, Methanone, (2,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]- represents a class of compounds that may have significant implications in drug design and development.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1/C19H19Cl2NO/c20-16-8-9-17(18(21)12-16)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2

InChI key: InChIKey=GSWFSJKTUCQXDL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• 2,4-Dichloro-4′-piperidinomethyl benzophenone
• Methanone, (2,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-
• (2,4-Dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone
• (2,4-Dichlorophenyl)(4-(piperidin-1-ylmethyl)phenyl)methanone