CAS 898775-57-0

Methanone, (2,5-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that it has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties. The compound also features a piperidinylmethyl group, suggesting potential interactions with biological systems, particularly in pharmacology. This structure may contribute to its lipophilicity, affecting its solubility and permeability in biological membranes. The compound is likely to exhibit specific biological activities, making it of interest in medicinal chemistry. Additionally, its molecular weight, melting point, and solubility characteristics would be essential for understanding its behavior in various environments. Safety data, including toxicity and handling precautions, would also be critical for laboratory work involving this substance. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research and application in various fields.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1S/C19H19Cl2NO/c20-16-8-9-18(21)17(12-16)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2

InChI key: InChIKey=PGLQFJRLVCRJLS-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(Cl)=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• Methanone, (2,5-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-
• 2,5-Dichloro-4′-piperidinomethyl benzophenone

2,5-dichloro-4′-piperidinomethyl benzophenone

CAS: 898775-57-0

Formula: C₁₉H₁₉Cl₂NO

Purity: 97.0%

Molecular weight: 348.27

Ref: 10-F204297