CAS 898775-59-2

Methanone, (3,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that the compound has chlorine substituents on the aromatic ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties related to piperidine derivatives, potentially affecting its pharmacological profile. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. Its molecular interactions, solubility, and stability would be influenced by the presence of the chlorine atoms and the piperidine moiety. As with many organic compounds, understanding its characteristics requires consideration of its synthesis, potential applications, and safety profile in handling and usage.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1S/C19H19Cl2NO/c20-17-9-8-16(12-18(17)21)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2

InChI key: InChIKey=MFTMFKRBKGPUMD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• 3,4-Dichloro-4′-piperidinomethyl benzophenone
• Methanone, (3,4-dichlorophenyl)[4-(1-piperidinylmethyl)phenyl]-

3,4-dichloro-4′-piperidinomethyl benzophenone

CAS: 898775-59-2

Formula: C₁₉H₁₉Cl₂NO

Purity: 97.0%

Molecular weight: 348.27

Ref: 10-F204298