CAS 898775-60-5

4-[3-(4-methoxyphenyl)propanoyl]benzonitrile

Description:

4-[3-(4-Methoxyphenyl)propanoyl]benzonitrile, with the CAS number 898775-60-5, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and a propanoyl group substituted with a methoxyphenyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the nitrile group (-C≡N) suggests that it may have polar characteristics, influencing its solubility in organic solvents. Additionally, the methoxy group (-OCH3) can enhance the compound's lipophilicity and may affect its biological activity. The compound's molecular structure indicates potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of compounds with specific biological activities. Its reactivity and interactions can be further explored through various analytical techniques, including NMR and mass spectrometry, to understand its behavior in different chemical environments.

Formula: C₁₇H₁₅NO₂

InChI: InChI=1/C17H15NO2/c1-20-16-9-4-13(5-10-16)6-11-17(19)15-7-2-14(12-18)3-8-15/h2-5,7-10H,6,11H2,1H3

SMILES: COc1ccc(cc1)CCC(=O)c1ccc(cc1)C#N

4′-cyano-3-(4-methoxyphenyl)propiophenone

CAS: 898775-60-5

Formula: C₁₇H₁₅NO₂

Purity: 97.0%

Molecular weight: 265.312

Ref: 10-F205891