CAS 898775-62-7
:ethyl 2-[3-(4-methoxyphenyl)propanoyl]benzoate
Description:
Ethyl 2-[3-(4-methoxyphenyl)propanoyl]benzoate, identified by its CAS number 898775-62-7, is an organic compound that belongs to the class of esters. This substance features a benzoate moiety, which is characteristic of aromatic compounds, and includes an ethyl group that contributes to its ester functionality. The presence of a 4-methoxyphenyl group indicates that the compound has a methoxy substituent on the aromatic ring, which can influence its solubility and reactivity. The structure suggests that it may exhibit interesting biological activities, potentially making it relevant in pharmaceutical applications. Ethyl esters like this compound are often used in organic synthesis and can serve as intermediates in the production of various chemical products. Additionally, the compound's molecular structure may impart specific physical properties such as melting point, boiling point, and solubility in different solvents, which are important for its practical applications. Overall, ethyl 2-[3-(4-methoxyphenyl)propanoyl]benzoate is a compound of interest in both synthetic and medicinal chemistry.
Formula:C19H20O4
InChI:InChI=1/C19H20O4/c1-3-23-19(21)17-7-5-4-6-16(17)18(20)13-10-14-8-11-15(22-2)12-9-14/h4-9,11-12H,3,10,13H2,1-2H3
InChI key:InChIKey=KXZASPJIXIYLGV-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccccc1C(=O)CCc1ccc(cc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.