CAS 898775-63-8

(2,4-difluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

(2,4-Difluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with CAS number 898775-63-8, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group and a piperidylmethyl-substituted phenyl moiety. This compound typically exhibits properties associated with aromatic ketones, including potential biological activity due to its ability to interact with various biological targets. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetics and pharmacodynamics. Additionally, the piperidine ring may contribute to its ability to cross biological membranes, making it of interest in medicinal chemistry. The compound's molecular interactions, solubility, and stability can vary based on environmental conditions such as pH and temperature. Overall, (2,4-difluorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone represents a class of compounds that may have applications in drug development or as research tools in biochemistry and pharmacology.

Formula: C₁₉H₁₉F₂NO

InChI: InChI=1/C19H19F2NO/c20-16-8-9-17(18(21)12-16)19(23)15-6-4-14(5-7-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2

SMILES: C1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccc(cc1F)F

2,4-difluoro-4′-piperidinomethyl benzophenone

CAS: 898775-63-8

Formula: C₁₉H₁₉F₂NO

Purity: 97.0%

Molecular weight: 315.364

Ref: 10-F204300