CymitQuimica logo

CAS 898775-66-1

:

ethyl 4-[3-(4-methoxyphenyl)propanoyl]benzoate

Description:
Ethyl 4-[3-(4-methoxyphenyl)propanoyl]benzoate, identified by its CAS number 898775-66-1, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a complex structure that includes a benzoate moiety, a propanoyl group, and a methoxy-substituted phenyl ring, contributing to its potential biological activity and chemical reactivity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the presence of aromatic rings and ester functionalities, which can influence their solubility in organic solvents. Ethyl 4-[3-(4-methoxyphenyl)propanoyl]benzoate may be of interest in medicinal chemistry and materials science, potentially serving as a precursor for the synthesis of more complex molecules or as a candidate for pharmacological studies. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C19H20O4
InChI:InChI=1/C19H20O4/c1-3-23-19(21)16-9-7-15(8-10-16)18(20)13-6-14-4-11-17(22-2)12-5-14/h4-5,7-12H,3,6,13H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1)C(=O)CCc1ccc(cc1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.