CAS 898775-67-2

Methanone, (3,5-difluorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[4-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-difluorophenyl group indicates that two fluorine atoms are substituted on the phenyl ring, which can influence the compound's reactivity and physical properties, such as polarity and boiling point. The compound also features a piperidinylmethyl substituent, suggesting potential interactions with biological systems, particularly in medicinal chemistry. This structure may confer specific pharmacological properties, making it of interest in drug development. The molecular interactions and stability of this compound can be affected by the electron-withdrawing nature of the fluorine atoms and the steric effects of the piperidine ring. Overall, Methanone, (3,5-difluorophenyl)[4-(1-piperidinylmethyl)phenyl]- is a compound that exemplifies the complexity of organic molecules, with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₉H₁₉F₂NO

InChI: InChI=1S/C19H19F2NO/c20-17-10-16(11-18(21)12-17)19(23)15-6-4-14(5-7-15)13-22-8-2-1-3-9-22/h4-7,10-12H,1-3,8-9,13H2

InChI key: InChIKey=FJXKVUPFBMOWRJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• Methanone, (3,5-difluorophenyl)[4-(1-piperidinylmethyl)phenyl]-
• (3,5-Difluorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone

3,5-difluoro-4′-piperidinomethyl benzophenone

CAS: 898775-67-2

Formula: C₁₉H₁₉F₂NO

Purity: 97.0%

Molecular weight: 315.364

Ref: 10-F204302