CAS 898775-68-3
:3-(4-methoxyphenyl)-1-(2-methylsulfanylphenyl)propan-1-one
Description:
3-(4-Methoxyphenyl)-1-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898775-68-3, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: a para-methoxyphenyl group and a 2-methylsulfanylphenyl group. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity, while the methylsulfanyl group can contribute to its reactivity and solubility characteristics. This compound is likely to exhibit moderate stability under standard conditions, but its reactivity may vary depending on the functional groups present. It may also show potential applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C17H18O2S
InChI:InChI=1/C17H18O2S/c1-19-14-10-7-13(8-11-14)9-12-16(18)15-5-3-4-6-17(15)20-2/h3-8,10-11H,9,12H2,1-2H3
SMILES:COc1ccc(cc1)CCC(=O)c1ccccc1SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.