CAS 898775-71-8
:cyclopropyl-[4-(1-piperidylmethyl)phenyl]methanone
Description:
Cyclopropyl-[4-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898775-71-8, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenyl ring substituted with a piperidylmethyl group, indicating the presence of a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This structural arrangement suggests potential biological activity, as piperidine derivatives are often found in pharmacologically active compounds. The methanone functional group indicates the presence of a carbonyl group (C=O) adjacent to the cyclopropyl moiety, which can influence the compound's reactivity and interactions. Overall, the combination of these functional groups may contribute to the compound's properties, including its solubility, stability, and potential applications in medicinal chemistry or as a synthetic intermediate. Further studies would be necessary to fully elucidate its chemical behavior and potential uses.
Formula:C16H21NO
InChI:InChI=1/C16H21NO/c18-16(15-8-9-15)14-6-4-13(5-7-14)12-17-10-2-1-3-11-17/h4-7,15H,1-3,8-12H2
SMILES:C1CCN(CC1)Cc1ccc(cc1)C(=O)C1CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.