CAS 898775-75-2

Cyclopentyl[4-(1-piperidinylmethyl)phenyl]methanone

Description:

Cyclopentyl[4-(1-piperidinylmethyl)phenyl]methanone, identified by its CAS number 898775-75-2, is a chemical compound characterized by its unique structure that includes a cyclopentyl group, a piperidinylmethyl substituent, and a phenyl ring. This compound typically exhibits properties associated with ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It may have moderate to high lipophilicity due to the presence of the cyclopentyl and phenyl groups, which can influence its solubility in organic solvents. The piperidine moiety may impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, Cyclopentyl[4-(1-piperidinylmethyl)phenyl]methanone represents a compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₈H₂₅NO

InChI: InChI=1S/C18H25NO/c20-18(16-6-2-3-7-16)17-10-8-15(9-11-17)14-19-12-4-1-5-13-19/h8-11,16H,1-7,12-14H2

InChI key: InChIKey=IUHXZTQCGQRVJK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3CCCC3

Synonyms:

• Cyclopentyl[4-(1-piperidinylmethyl)phenyl]methanone
• Methanone, cyclopentyl[4-(1-piperidinylmethyl)phenyl]-