CAS 898775-77-4

Cyclohexyl[4-(1-piperidinylmethyl)phenyl]methanone

Description:

Cyclohexyl[4-(1-piperidinylmethyl)phenyl]methanone, identified by its CAS number 898775-77-4, is a chemical compound characterized by its unique structure that includes a cyclohexyl group, a piperidinylmethyl substituent, and a phenyl ring. This compound typically exhibits properties associated with ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It may possess moderate to high lipophilicity due to the presence of the cyclohexyl and phenyl groups, which can influence its solubility in organic solvents. The piperidine moiety may impart certain biological activities, making this compound of interest in medicinal chemistry and drug development. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₉H₂₇NO

InChI: InChI=1S/C19H27NO/c21-19(17-7-3-1-4-8-17)18-11-9-16(10-12-18)15-20-13-5-2-6-14-20/h9-12,17H,1-8,13-15H2

InChI key: InChIKey=HLIKRRNRSBSPSA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3CCCCC3

Synonyms:

• Methanone, cyclohexyl[4-(1-piperidinylmethyl)phenyl]-
• Cyclohexyl[4-(1-piperidinylmethyl)phenyl]methanone

cyclohexyl 4-(piperidinomethyl)phenyl ketone

CAS: 898775-77-4

Formula: C₁₉H₂₇NO

Purity: 97.0%

Molecular weight: 285.431

Ref: 10-F204307